C21H23ClN4O2S — CID 87267492
N-[6-[6-chloro-5-(propan-2-ylamino)-3-pyridinyl]-1,3-benzothiazol-2-yl]-2-[(2S)-oxolan-2-yl]acetamide (PubChem CID 87267492) has the molecular formula C21H23ClN4O2S and a molecular weight of 430.96 g/mol. Its IUPAC name is N-[6-[6-chloro-5-(propan-2-ylamino)-3-pyridinyl]-1,3-benzothiazol-2-yl]-2-[(2S)-oxolan-2-yl]acetamide.
| Compound Name | N-[6-[6-chloro-5-(propan-2-ylamino)-3-pyridinyl]-1,3-benzothiazol-2-yl]-2-[(2S)-oxolan-2-yl]acetamide |
|---|---|
| PubChem CID | 87267492 |
| Molecular Formula | C21H23ClN4O2S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | N-[6-[6-chloro-5-(propan-2-ylamino)-3-pyridinyl]-1,3-benzothiazol-2-yl]-2-[(2S)-oxolan-2-yl]acetamide |
| SMILES | CC(C)Nc1cc(-c2ccc3nc(NC(=O)C[C@@H]4CCCO4)sc3c2)cnc1Cl |
| InChI | InChI=1S/C21H23ClN4O2S/c1-12(2)24-17-8-14(11-23-20(17)22)13-5-6-16-18(9-13)29-21(25-16)26-19(27)10-15-4-3-7-28-15/h5-6,8-9,11-12,15,24H,3-4,7,10H2,1-2H3,(H,25,26,27)/t15-/m0/s1 |
| InChIKey | NCCMMQUPPIJEIL-HNNXBMFYSA-N |
| XLogP | 5.34 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|