C33H37N3O7 — CID 46368946
N-cyclohexyl-2,3-bis(3,4,5-trimethoxyphenyl)quinoxaline-6-carboxamide (PubChem CID 46368946) has the molecular formula C33H37N3O7 and a molecular weight of 587.67 g/mol. Its IUPAC name is N-cyclohexyl-2,3-bis(3,4,5-trimethoxyphenyl)quinoxaline-6-carboxamide.
| Compound Name | N-cyclohexyl-2,3-bis(3,4,5-trimethoxyphenyl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 46368946 |
| Molecular Formula | C33H37N3O7 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | N-cyclohexyl-2,3-bis(3,4,5-trimethoxyphenyl)quinoxaline-6-carboxamide |
| SMILES | COc1cc(-c2nc3ccc(C(=O)NC4CCCCC4)cc3nc2-c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C33H37N3O7/c1-38-25-15-20(16-26(39-2)31(25)42-5)29-30(21-17-27(40-3)32(43-6)28(18-21)41-4)36-24-14-19(12-13-23(24)35-29)33(37)34-22-10-8-7-9-11-22/h12-18,22H,7-11H2,1-6H3,(H,34,37) |
| InChIKey | LKUWBADHOWELTJ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |