C20H26N4O4 — CID 109250436
N-cyclohexyl-2-(3,4,5-trimethoxyanilino)pyrimidine-5-carboxamide (PubChem CID 109250436) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,4,5-trimethoxyanilino)pyrimidine-5-carboxamide.
| Compound Name | N-cyclohexyl-2-(3,4,5-trimethoxyanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109250436 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-cyclohexyl-2-(3,4,5-trimethoxyanilino)pyrimidine-5-carboxamide |
| SMILES | COc1cc(Nc2ncc(C(=O)NC3CCCCC3)cn2)cc(OC)c1OC |
| InChI | InChI=1S/C20H26N4O4/c1-26-16-9-15(10-17(27-2)18(16)28-3)24-20-21-11-13(12-22-20)19(25)23-14-7-5-4-6-8-14/h9-12,14H,4-8H2,1-3H3,(H,23,25)(H,21,22,24) |
| InChIKey | KWSDFZCALCKAJM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |