C24H32ClN3O — CID 20866048
9-chloro-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5,6,7,8-tetrahydroacridine-3-carboxamide (PubChem CID 20866048) has the molecular formula C24H32ClN3O and a molecular weight of 413.99 g/mol. Its IUPAC name is 9-chloro-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5,6,7,8-tetrahydroacridine-3-carboxamide.
| Compound Name | 9-chloro-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5,6,7,8-tetrahydroacridine-3-carboxamide |
|---|---|
| PubChem CID | 20866048 |
| Molecular Formula | C24H32ClN3O |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 9-chloro-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5,6,7,8-tetrahydroacridine-3-carboxamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)c2ccc3c(Cl)c4c(nc3c2)CCCC4)C1 |
| InChI | InChI=1S/C24H32ClN3O/c1-16-12-17(2)15-28(14-16)11-5-10-26-24(29)18-8-9-20-22(13-18)27-21-7-4-3-6-19(21)23(20)25/h8-9,13,16-17H,3-7,10-12,14-15H2,1-2H3,(H,26,29) |
| InChIKey | FRNPRPFYKBRBAW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|