C18H28ClN3O4S — CID 55765667
4-chloro-3-[methoxy(methyl)sulfamoyl]-N-[3-(3-methylpiperidin-1-yl)propyl]benzamide (PubChem CID 55765667) has the molecular formula C18H28ClN3O4S and a molecular weight of 417.96 g/mol. Its IUPAC name is 4-chloro-3-[methoxy(methyl)sulfamoyl]-N-[3-(3-methylpiperidin-1-yl)propyl]benzamide.
| Compound Name | 4-chloro-3-[methoxy(methyl)sulfamoyl]-N-[3-(3-methylpiperidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 55765667 |
| Molecular Formula | C18H28ClN3O4S |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-chloro-3-[methoxy(methyl)sulfamoyl]-N-[3-(3-methylpiperidin-1-yl)propyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)NCCCN2CCCC(C)C2)ccc1Cl |
| InChI | InChI=1S/C18H28ClN3O4S/c1-14-6-4-10-22(13-14)11-5-9-20-18(23)15-7-8-16(19)17(12-15)27(24,25)21(2)26-3/h7-8,12,14H,4-6,9-11,13H2,1-3H3,(H,20,23) |
| InChIKey | XIAOMWMETSLYQW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|