C18H28ClN3O3S — CID 53278155
2-chloro-4-[methyl(methylsulfonyl)amino]-N-[3-(3-methylpiperidin-1-yl)propyl]benzamide (PubChem CID 53278155) has the molecular formula C18H28ClN3O3S and a molecular weight of 401.96 g/mol. Its IUPAC name is 2-chloro-4-[methyl(methylsulfonyl)amino]-N-[3-(3-methylpiperidin-1-yl)propyl]benzamide.
| Compound Name | 2-chloro-4-[methyl(methylsulfonyl)amino]-N-[3-(3-methylpiperidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 53278155 |
| Molecular Formula | C18H28ClN3O3S |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 2-chloro-4-[methyl(methylsulfonyl)amino]-N-[3-(3-methylpiperidin-1-yl)propyl]benzamide |
| SMILES | CC1CCCN(CCCNC(=O)c2ccc(N(C)S(C)(=O)=O)cc2Cl)C1 |
| InChI | InChI=1S/C18H28ClN3O3S/c1-14-6-4-10-22(13-14)11-5-9-20-18(23)16-8-7-15(12-17(16)19)21(2)26(3,24)25/h7-8,12,14H,4-6,9-11,13H2,1-3H3,(H,20,23) |
| InChIKey | QLFJXDWVJRDASF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|