C15H21ClN2O3S — CID 53278229
N-[3-chloro-4-(4-methylpiperidine-1-carbonyl)phenyl]-N-methylmethanesulfonamide (PubChem CID 53278229) has the molecular formula C15H21ClN2O3S and a molecular weight of 344.86 g/mol. Its IUPAC name is N-[3-chloro-4-(4-methylpiperidine-1-carbonyl)phenyl]-N-methylmethanesulfonamide.
| Compound Name | N-[3-chloro-4-(4-methylpiperidine-1-carbonyl)phenyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 53278229 |
| Molecular Formula | C15H21ClN2O3S |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-[3-chloro-4-(4-methylpiperidine-1-carbonyl)phenyl]-N-methylmethanesulfonamide |
| SMILES | CC1CCN(C(=O)c2ccc(N(C)S(C)(=O)=O)cc2Cl)CC1 |
| InChI | InChI=1S/C15H21ClN2O3S/c1-11-6-8-18(9-7-11)15(19)13-5-4-12(10-14(13)16)17(2)22(3,20)21/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | VHYZKTSBWIQYDH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |