C14H18ClNO3S — CID 26773669
(4-chloro-3-methylsulfonylphenyl)-(4-methylpiperidin-1-yl)methanone (PubChem CID 26773669) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is (4-chloro-3-methylsulfonylphenyl)-(4-methylpiperidin-1-yl)methanone.
| Compound Name | (4-chloro-3-methylsulfonylphenyl)-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 26773669 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (4-chloro-3-methylsulfonylphenyl)-(4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2ccc(Cl)c(S(C)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C14H18ClNO3S/c1-10-5-7-16(8-6-10)14(17)11-3-4-12(15)13(9-11)20(2,18)19/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | ZMJAYPJTNCKKKI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |