C14H18Cl2N2O3S — CID 48734210
N-[1-(3,4-dichlorobenzoyl)piperidin-4-yl]-N-methylmethanesulfonamide (PubChem CID 48734210) has the molecular formula C14H18Cl2N2O3S and a molecular weight of 365.28 g/mol. Its IUPAC name is N-[1-(3,4-dichlorobenzoyl)piperidin-4-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[1-(3,4-dichlorobenzoyl)piperidin-4-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 48734210 |
| Molecular Formula | C14H18Cl2N2O3S |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | N-[1-(3,4-dichlorobenzoyl)piperidin-4-yl]-N-methylmethanesulfonamide |
| SMILES | CN(C1CCN(C(=O)c2ccc(Cl)c(Cl)c2)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C14H18Cl2N2O3S/c1-17(22(2,20)21)11-5-7-18(8-6-11)14(19)10-3-4-12(15)13(16)9-10/h3-4,9,11H,5-8H2,1-2H3 |
| InChIKey | NVDZEPFEZDVQNR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |