C19H30ClN3O3S — CID 100727602
2-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]acetamide (PubChem CID 100727602) has the molecular formula C19H30ClN3O3S and a molecular weight of 415.99 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]acetamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 100727602 |
| Molecular Formula | C19H30ClN3O3S |
| Molecular Weight | 415.99 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]acetamide |
| SMILES | C[C@@H]1CCCN(CCCNC(=O)CN(Cc2ccccc2Cl)S(C)(=O)=O)C1 |
| InChI | InChI=1S/C19H30ClN3O3S/c1-16-7-5-11-22(13-16)12-6-10-21-19(24)15-23(27(2,25)26)14-17-8-3-4-9-18(17)20/h3-4,8-9,16H,5-7,10-15H2,1-2H3,(H,21,24)/t16-/m1/s1 |
| InChIKey | OTECAHSBUCQRSY-MRXNPFEDSA-N |
| XLogP | 2.34 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.99 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|