C20H19F3N2O2 — CID 134801187
N-[2-(cyclopropylmethylamino)-2-oxoethyl]-3-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 134801187) has the molecular formula C20H19F3N2O2 and a molecular weight of 376.38 g/mol. Its IUPAC name is N-[2-(cyclopropylmethylamino)-2-oxoethyl]-3-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[2-(cyclopropylmethylamino)-2-oxoethyl]-3-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 134801187 |
| Molecular Formula | C20H19F3N2O2 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-[2-(cyclopropylmethylamino)-2-oxoethyl]-3-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(-c2ccc(C(F)(F)F)cc2)c1)NCC1CC1 |
| InChI | InChI=1S/C20H19F3N2O2/c21-20(22,23)17-8-6-14(7-9-17)15-2-1-3-16(10-15)19(27)25-12-18(26)24-11-13-4-5-13/h1-3,6-10,13H,4-5,11-12H2,(H,24,26)(H,25,27) |
| InChIKey | FBODGLDTWFUABN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |