C19H27N3O — CID 84613024
N-(3-aminopropyl)-4-(1-methylindol-3-yl)cyclohexane-1-carboxamide (PubChem CID 84613024) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-(1-methylindol-3-yl)cyclohexane-1-carboxamide.
| Compound Name | N-(3-aminopropyl)-4-(1-methylindol-3-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 84613024 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | N-(3-aminopropyl)-4-(1-methylindol-3-yl)cyclohexane-1-carboxamide |
| SMILES | Cn1cc(C2CCC(C(=O)NCCCN)CC2)c2ccccc21 |
| InChI | InChI=1S/C19H27N3O/c1-22-13-17(16-5-2-3-6-18(16)22)14-7-9-15(10-8-14)19(23)21-12-4-11-20/h2-3,5-6,13-15H,4,7-12,20H2,1H3,(H,21,23) |
| InChIKey | WUHZSPHPKFHTOP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|