C24H36N6O3 — CID 70969581
1-(4-aminobutyl)-N-[1-[2-(cyclopropanecarbonylamino)ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide (PubChem CID 70969581) has the molecular formula C24H36N6O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is 1-(4-aminobutyl)-N-[1-[2-(cyclopropanecarbonylamino)ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide.
| Compound Name | 1-(4-aminobutyl)-N-[1-[2-(cyclopropanecarbonylamino)ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 70969581 |
| Molecular Formula | C24H36N6O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 1-(4-aminobutyl)-N-[1-[2-(cyclopropanecarbonylamino)ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide |
| SMILES | CC(C)(C)C(NC(=O)c1nn(CCCCN)c2ccccc12)C(=O)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C24H36N6O3/c1-24(2,3)20(23(33)27-14-13-26-21(31)16-10-11-16)28-22(32)19-17-8-4-5-9-18(17)30(29-19)15-7-6-12-25/h4-5,8-9,16,20H,6-7,10-15,25H2,1-3H3,(H,26,31)(H,27,33)(H,28,32) |
| InChIKey | DHFJTEFZAXUVCL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 131.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|