C27H43N5O5 — CID 169175623
N-[1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-1-pent-4-enylindazole-3-carboxamide (PubChem CID 169175623) has the molecular formula C27H43N5O5 and a molecular weight of 517.67 g/mol. Its IUPAC name is N-[1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-1-pent-4-enylindazole-3-carboxamide.
| Compound Name | N-[1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-1-pent-4-enylindazole-3-carboxamide |
|---|---|
| PubChem CID | 169175623 |
| Molecular Formula | C27H43N5O5 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.33 |
| IUPAC Name | N-[1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-1-pent-4-enylindazole-3-carboxamide |
| SMILES | C=CCCCn1nc(C(=O)NC(C(=O)NCCOCCOCCOCCN)C(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C27H43N5O5/c1-5-6-9-14-32-22-11-8-7-10-21(22)23(31-32)25(33)30-24(27(2,3)4)26(34)29-13-16-36-18-20-37-19-17-35-15-12-28/h5,7-8,10-11,24H,1,6,9,12-20,28H2,2-4H3,(H,29,34)(H,30,33) |
| InChIKey | LSGNWLWSGNXQBX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|