C20H32N4O2Si — CID 172871875
N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(3-trimethylsilylpropyl)indazole-3-carboxamide (PubChem CID 172871875) has the molecular formula C20H32N4O2Si and a molecular weight of 388.59 g/mol. Its IUPAC name is N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(3-trimethylsilylpropyl)indazole-3-carboxamide.
| Compound Name | N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(3-trimethylsilylpropyl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 172871875 |
| Molecular Formula | C20H32N4O2Si |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(3-trimethylsilylpropyl)indazole-3-carboxamide |
| SMILES | CC(C)(C)[C@H](NC(=O)c1nn(CCC[Si](C)(C)C)c2ccccc12)C(N)=O |
| InChI | InChI=1S/C20H32N4O2Si/c1-20(2,3)17(18(21)25)22-19(26)16-14-10-7-8-11-15(14)24(23-16)12-9-13-27(4,5)6/h7-8,10-11,17H,9,12-13H2,1-6H3,(H2,21,25)(H,22,26)/t17-/m1/s1 |
| InChIKey | LJKMOYFTWIBFJI-QGZVFWFLSA-N |
| XLogP | 3.39 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|