C20H26N4O2 — CID 169175694
N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-1-pent-4-ynylindazole-3-carboxamide (PubChem CID 169175694) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-1-pent-4-ynylindazole-3-carboxamide.
| Compound Name | N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-1-pent-4-ynylindazole-3-carboxamide |
|---|---|
| PubChem CID | 169175694 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-1-pent-4-ynylindazole-3-carboxamide |
| SMILES | C#CCCCn1nc(C(=O)N[C@H](C(=O)NC)C(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C20H26N4O2/c1-6-7-10-13-24-15-12-9-8-11-14(15)16(23-24)18(25)22-17(19(26)21-5)20(2,3)4/h1,8-9,11-12,17H,7,10,13H2,2-5H3,(H,21,26)(H,22,25)/t17-/m1/s1 |
| InChIKey | FKYGPOSWAICLDS-QGZVFWFLSA-N |
| XLogP | 2.34 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|