C18H24FN3O4 — CID 166451397
(2S)-2-[[1-(4-fluorobutyl)indazole-3-carbonyl]amino]-4-hydroxy-3,3-dimethylbutanoic acid (PubChem CID 166451397) has the molecular formula C18H24FN3O4 and a molecular weight of 365.41 g/mol. Its IUPAC name is (2S)-2-[[1-(4-fluorobutyl)indazole-3-carbonyl]amino]-4-hydroxy-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[[1-(4-fluorobutyl)indazole-3-carbonyl]amino]-4-hydroxy-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 166451397 |
| Molecular Formula | C18H24FN3O4 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (2S)-2-[[1-(4-fluorobutyl)indazole-3-carbonyl]amino]-4-hydroxy-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(CO)[C@H](NC(=O)c1nn(CCCCF)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C18H24FN3O4/c1-18(2,11-23)15(17(25)26)20-16(24)14-12-7-3-4-8-13(12)22(21-14)10-6-5-9-19/h3-4,7-8,15,23H,5-6,9-11H2,1-2H3,(H,20,24)(H,25,26)/t15-/m1/s1 |
| InChIKey | HAWKVYRHVGKLEC-OAHLLOKOSA-N |
| XLogP | 1.99 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|