C23H27FN4O2 — CID 156818007
N-[2-(3-carbamoylphenyl)propan-2-yl]-1-(5-fluoropentyl)indazole-3-carboxamide (PubChem CID 156818007) has the molecular formula C23H27FN4O2 and a molecular weight of 410.49 g/mol. Its IUPAC name is N-[2-(3-carbamoylphenyl)propan-2-yl]-1-(5-fluoropentyl)indazole-3-carboxamide.
| Compound Name | N-[2-(3-carbamoylphenyl)propan-2-yl]-1-(5-fluoropentyl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 156818007 |
| Molecular Formula | C23H27FN4O2 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | N-[2-(3-carbamoylphenyl)propan-2-yl]-1-(5-fluoropentyl)indazole-3-carboxamide |
| SMILES | CC(C)(NC(=O)c1nn(CCCCCF)c2ccccc12)c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C23H27FN4O2/c1-23(2,17-10-8-9-16(15-17)21(25)29)26-22(30)20-18-11-4-5-12-19(18)28(27-20)14-7-3-6-13-24/h4-5,8-12,15H,3,6-7,13-14H2,1-2H3,(H2,25,29)(H,26,30) |
| InChIKey | ASOXUSRDPYXDQD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|