C22H33N5O3 — CID 70969964
1-(4-aminobutyl)-N-[1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide (PubChem CID 70969964) has the molecular formula C22H33N5O3 and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-(4-aminobutyl)-N-[1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide.
| Compound Name | 1-(4-aminobutyl)-N-[1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 70969964 |
| Molecular Formula | C22H33N5O3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | 1-(4-aminobutyl)-N-[1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide |
| SMILES | CC(C)(C)C(NC(=O)c1nn(CCCCN)c2ccccc12)C(=O)N1CCC(O)C1 |
| InChI | InChI=1S/C22H33N5O3/c1-22(2,3)19(21(30)26-13-10-15(28)14-26)24-20(29)18-16-8-4-5-9-17(16)27(25-18)12-7-6-11-23/h4-5,8-9,15,19,28H,6-7,10-14,23H2,1-3H3,(H,24,29) |
| InChIKey | TUAQBFTUYAHVNP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|