C22H34N4O2 — CID 169175691
but-1-ene;1-ethyl-N-[1-(ethylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide (PubChem CID 169175691) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is but-1-ene;1-ethyl-N-[1-(ethylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide.
| Compound Name | but-1-ene;1-ethyl-N-[1-(ethylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 169175691 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | but-1-ene;1-ethyl-N-[1-(ethylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide |
| SMILES | C=CCC.CCNC(=O)C(NC(=O)c1nn(CC)c2ccccc12)C(C)(C)C |
| InChI | InChI=1S/C18H26N4O2.C4H8/c1-6-19-17(24)15(18(3,4)5)20-16(23)14-12-10-8-9-11-13(12)22(7-2)21-14;1-3-4-2/h8-11,15H,6-7H2,1-5H3,(H,19,24)(H,20,23);3H,1,4H2,2H3 |
| InChIKey | UZSMXULHEXDRHW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|