C21H32ClN5O4 — CID 70969974
1-(4-aminobutyl)-7-chloro-N-[1-(2,3-dihydroxypropylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide (PubChem CID 70969974) has the molecular formula C21H32ClN5O4 and a molecular weight of 453.97 g/mol. Its IUPAC name is 1-(4-aminobutyl)-7-chloro-N-[1-(2,3-dihydroxypropylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide.
| Compound Name | 1-(4-aminobutyl)-7-chloro-N-[1-(2,3-dihydroxypropylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 70969974 |
| Molecular Formula | C21H32ClN5O4 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 1-(4-aminobutyl)-7-chloro-N-[1-(2,3-dihydroxypropylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide |
| SMILES | CC(C)(C)C(NC(=O)c1nn(CCCCN)c2c(Cl)cccc12)C(=O)NCC(O)CO |
| InChI | InChI=1S/C21H32ClN5O4/c1-21(2,3)18(20(31)24-11-13(29)12-28)25-19(30)16-14-7-6-8-15(22)17(14)27(26-16)10-5-4-9-23/h6-8,13,18,28-29H,4-5,9-12,23H2,1-3H3,(H,24,31)(H,25,30) |
| InChIKey | MFWDGFIUBWSEEK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|