C21H28FN5O3 — CID 68893964
1-(4-cyanobutyl)-7-fluoro-N-[(2S)-1-(2-hydroxyethylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide (PubChem CID 68893964) has the molecular formula C21H28FN5O3 and a molecular weight of 417.49 g/mol. Its IUPAC name is 1-(4-cyanobutyl)-7-fluoro-N-[(2S)-1-(2-hydroxyethylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide.
| Compound Name | 1-(4-cyanobutyl)-7-fluoro-N-[(2S)-1-(2-hydroxyethylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 68893964 |
| Molecular Formula | C21H28FN5O3 |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 1-(4-cyanobutyl)-7-fluoro-N-[(2S)-1-(2-hydroxyethylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide |
| SMILES | CC(C)(C)[C@H](NC(=O)c1nn(CCCCC#N)c2c(F)cccc12)C(=O)NCCO |
| InChI | InChI=1S/C21H28FN5O3/c1-21(2,3)18(20(30)24-11-13-28)25-19(29)16-14-8-7-9-15(22)17(14)27(26-16)12-6-4-5-10-23/h7-9,18,28H,4-6,11-13H2,1-3H3,(H,24,30)(H,25,29)/t18-/m1/s1 |
| InChIKey | WUMDIAZCVHEPKP-GOSISDBHSA-N |
| XLogP | 2.12 |
| TPSA | 120.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|