C22H30FN5O3 — CID 68893689
1-(4-cyanobutyl)-6-fluoro-N-[(2S)-1-(3-hydroxypropylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide (PubChem CID 68893689) has the molecular formula C22H30FN5O3 and a molecular weight of 431.51 g/mol. Its IUPAC name is 1-(4-cyanobutyl)-6-fluoro-N-[(2S)-1-(3-hydroxypropylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide.
| Compound Name | 1-(4-cyanobutyl)-6-fluoro-N-[(2S)-1-(3-hydroxypropylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 68893689 |
| Molecular Formula | C22H30FN5O3 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 1-(4-cyanobutyl)-6-fluoro-N-[(2S)-1-(3-hydroxypropylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide |
| SMILES | CC(C)(C)[C@H](NC(=O)c1nn(CCCCC#N)c2cc(F)ccc12)C(=O)NCCCO |
| InChI | InChI=1S/C22H30FN5O3/c1-22(2,3)19(21(31)25-11-7-13-29)26-20(30)18-16-9-8-15(23)14-17(16)28(27-18)12-6-4-5-10-24/h8-9,14,19,29H,4-7,11-13H2,1-3H3,(H,25,31)(H,26,30)/t19-/m1/s1 |
| InChIKey | NIGXFRDTUAAURJ-LJQANCHMSA-N |
| XLogP | 2.51 |
| TPSA | 120.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|