C23H28FN5O4 — CID 89148559
1-[(4-aminophenyl)methyl]-6-fluoro-N-[1-(hydroxymethoxymethylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide (PubChem CID 89148559) has the molecular formula C23H28FN5O4 and a molecular weight of 457.51 g/mol. Its IUPAC name is 1-[(4-aminophenyl)methyl]-6-fluoro-N-[1-(hydroxymethoxymethylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide.
| Compound Name | 1-[(4-aminophenyl)methyl]-6-fluoro-N-[1-(hydroxymethoxymethylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 89148559 |
| Molecular Formula | C23H28FN5O4 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 1-[(4-aminophenyl)methyl]-6-fluoro-N-[1-(hydroxymethoxymethylamino)-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide |
| SMILES | CC(C)(C)C(NC(=O)c1nn(Cc2ccc(N)cc2)c2cc(F)ccc12)C(=O)NCOCO |
| InChI | InChI=1S/C23H28FN5O4/c1-23(2,3)20(22(32)26-12-33-13-30)27-21(31)19-17-9-6-15(24)10-18(17)29(28-19)11-14-4-7-16(25)8-5-14/h4-10,20,30H,11-13,25H2,1-3H3,(H,26,32)(H,27,31) |
| InChIKey | XJWXCCBCXUDOKJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|