C26H33N5O3 — CID 89148543
1-[(4-aminophenyl)methyl]-N-[1-[[(1S)-2-(hydroxymethyl)cyclopropyl]methylamino]-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide (PubChem CID 89148543) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is 1-[(4-aminophenyl)methyl]-N-[1-[[(1S)-2-(hydroxymethyl)cyclopropyl]methylamino]-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide.
| Compound Name | 1-[(4-aminophenyl)methyl]-N-[1-[[(1S)-2-(hydroxymethyl)cyclopropyl]methylamino]-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 89148543 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 1-[(4-aminophenyl)methyl]-N-[1-[[(1S)-2-(hydroxymethyl)cyclopropyl]methylamino]-3,3-dimethyl-1-oxobutan-2-yl]indazole-3-carboxamide |
| SMILES | CC(C)(C)C(NC(=O)c1nn(Cc2ccc(N)cc2)c2ccccc12)C(=O)NC[C@H]1CC1CO |
| InChI | InChI=1S/C26H33N5O3/c1-26(2,3)23(25(34)28-13-17-12-18(17)15-32)29-24(33)22-20-6-4-5-7-21(20)31(30-22)14-16-8-10-19(27)11-9-16/h4-11,17-18,23,32H,12-15,27H2,1-3H3,(H,28,34)(H,29,33)/t17-,18?,23?/m1/s1 |
| InChIKey | TXRBRSAYXNJSGE-GBFLJEJBSA-N |
| XLogP | 2.56 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|