C28H25F3N2O — CID 25066524
[4-(1-benzylindol-3-yl)piperidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 25066524) has the molecular formula C28H25F3N2O and a molecular weight of 462.52 g/mol. Its IUPAC name is [4-(1-benzylindol-3-yl)piperidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(1-benzylindol-3-yl)piperidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 25066524 |
| Molecular Formula | C28H25F3N2O |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [4-(1-benzylindol-3-yl)piperidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCC(c2cn(Cc3ccccc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C28H25F3N2O/c29-28(30,31)23-12-10-22(11-13-23)27(34)32-16-14-21(15-17-32)25-19-33(18-20-6-2-1-3-7-20)26-9-5-4-8-24(25)26/h1-13,19,21H,14-18H2 |
| InChIKey | BCNZSYADPLXGJJ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |