C31H27F3N2O2S — CID 46089924
3-(1-naphthalen-2-ylsulfonylpiperidin-4-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]indole (PubChem CID 46089924) has the molecular formula C31H27F3N2O2S and a molecular weight of 548.63 g/mol. Its IUPAC name is 3-(1-naphthalen-2-ylsulfonylpiperidin-4-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]indole.
| Compound Name | 3-(1-naphthalen-2-ylsulfonylpiperidin-4-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]indole |
|---|---|
| PubChem CID | 46089924 |
| Molecular Formula | C31H27F3N2O2S |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | 3-(1-naphthalen-2-ylsulfonylpiperidin-4-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]indole |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CCC(c2cn(Cc3ccc(C(F)(F)F)cc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C31H27F3N2O2S/c32-31(33,34)26-12-9-22(10-13-26)20-35-21-29(28-7-3-4-8-30(28)35)24-15-17-36(18-16-24)39(37,38)27-14-11-23-5-1-2-6-25(23)19-27/h1-14,19,21,24H,15-18,20H2 |
| InChIKey | AVAVUCDEFKVXKE-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |