C29H28FN3O — CID 135268146
[4-[1-[(4-fluorophenyl)methyl]indol-3-yl]piperidin-1-yl]-[3-(methyliminomethyl)phenyl]methanone (PubChem CID 135268146) has the molecular formula C29H28FN3O and a molecular weight of 453.56 g/mol. Its IUPAC name is [4-[1-[(4-fluorophenyl)methyl]indol-3-yl]piperidin-1-yl]-[3-(methyliminomethyl)phenyl]methanone.
| Compound Name | [4-[1-[(4-fluorophenyl)methyl]indol-3-yl]piperidin-1-yl]-[3-(methyliminomethyl)phenyl]methanone |
|---|---|
| PubChem CID | 135268146 |
| Molecular Formula | C29H28FN3O |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | [4-[1-[(4-fluorophenyl)methyl]indol-3-yl]piperidin-1-yl]-[3-(methyliminomethyl)phenyl]methanone |
| SMILES | C/N=C/c1cccc(C(=O)N2CCC(c3cn(Cc4ccc(F)cc4)c4ccccc34)CC2)c1 |
| InChI | InChI=1S/C29H28FN3O/c1-31-18-22-5-4-6-24(17-22)29(34)32-15-13-23(14-16-32)27-20-33(28-8-3-2-7-26(27)28)19-21-9-11-25(30)12-10-21/h2-12,17-18,20,23H,13-16,19H2,1H3/b31-18+ |
| InChIKey | GCCFIOOLTDQIFM-FDAWAROLSA-N |
| XLogP | 5.90 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|