C25H26FN3O — CID 124763614
(1S,6S,7R)-N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 124763614) has the molecular formula C25H26FN3O and a molecular weight of 403.50 g/mol. Its IUPAC name is (1S,6S,7R)-N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1S,6S,7R)-N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 124763614 |
| Molecular Formula | C25H26FN3O |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (1S,6S,7R)-N-[(Z)-[1-[(4-fluorophenyl)methyl]indol-3-yl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | C[C@]12CCCC[C@H]1[C@H]2C(=O)N/N=C\c1cn(Cc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H26FN3O/c1-25-13-5-4-7-21(25)23(25)24(30)28-27-14-18-16-29(22-8-3-2-6-20(18)22)15-17-9-11-19(26)12-10-17/h2-3,6,8-12,14,16,21,23H,4-5,7,13,15H2,1H3,(H,28,30)/b27-14-/t21-,23-,25-/m0/s1 |
| InChIKey | VOSBNNBYIMQNBN-FARXYTRDSA-N |
| XLogP | 5.11 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|