C23H29N3O3 — CID 98078976
ethyl 2-[2-methyl-3-[(Z)-[[(1S,6R,7S)-1-methylbicyclo[4.1.0]heptane-7-carbonyl]hydrazinylidene]methyl]indol-1-yl]acetate (PubChem CID 98078976) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is ethyl 2-[2-methyl-3-[(Z)-[[(1S,6R,7S)-1-methylbicyclo[4.1.0]heptane-7-carbonyl]hydrazinylidene]methyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[2-methyl-3-[(Z)-[[(1S,6R,7S)-1-methylbicyclo[4.1.0]heptane-7-carbonyl]hydrazinylidene]methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 98078976 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | ethyl 2-[2-methyl-3-[(Z)-[[(1S,6R,7S)-1-methylbicyclo[4.1.0]heptane-7-carbonyl]hydrazinylidene]methyl]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C)c(/C=N\NC(=O)[C@H]2[C@H]3CCCC[C@@]32C)c2ccccc21 |
| InChI | InChI=1S/C23H29N3O3/c1-4-29-20(27)14-26-15(2)17(16-9-5-6-11-19(16)26)13-24-25-22(28)21-18-10-7-8-12-23(18,21)3/h5-6,9,11,13,18,21H,4,7-8,10,12,14H2,1-3H3,(H,25,28)/b24-13-/t18-,21-,23+/m1/s1 |
| InChIKey | WNFAFUPUXHDCRT-PRVUYJKVSA-N |
| XLogP | 3.79 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|