C23H28N2O2 — CID 126050744
(1S,6S,7R)-1-methyl-N-[(Z)-(2-propoxynaphthalen-1-yl)methylideneamino]bicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 126050744) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (1S,6S,7R)-1-methyl-N-[(Z)-(2-propoxynaphthalen-1-yl)methylideneamino]bicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1S,6S,7R)-1-methyl-N-[(Z)-(2-propoxynaphthalen-1-yl)methylideneamino]bicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 126050744 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (1S,6S,7R)-1-methyl-N-[(Z)-(2-propoxynaphthalen-1-yl)methylideneamino]bicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | CCCOc1ccc2ccccc2c1/C=N\NC(=O)[C@@H]1[C@@H]2CCCC[C@]12C |
| InChI | InChI=1S/C23H28N2O2/c1-3-14-27-20-12-11-16-8-4-5-9-17(16)18(20)15-24-25-22(26)21-19-10-6-7-13-23(19,21)2/h4-5,8-9,11-12,15,19,21H,3,6-7,10,13-14H2,1-2H3,(H,25,26)/b24-15-/t19-,21-,23-/m0/s1 |
| InChIKey | BEYLVPBOPOVHQE-TZWRGEHKSA-N |
| XLogP | 4.91 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|