C18H22N2O4 — CID 98078960
2-[4-[(Z)-[[(1R,6S,7S)-1-methylbicyclo[4.1.0]heptane-7-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 98078960) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-[4-[(Z)-[[(1R,6S,7S)-1-methylbicyclo[4.1.0]heptane-7-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[[(1R,6S,7S)-1-methylbicyclo[4.1.0]heptane-7-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 98078960 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-[4-[(Z)-[[(1R,6S,7S)-1-methylbicyclo[4.1.0]heptane-7-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | C[C@@]12CCCC[C@H]1[C@@H]2C(=O)N/N=C\c1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C18H22N2O4/c1-18-9-3-2-4-14(18)16(18)17(23)20-19-10-12-5-7-13(8-6-12)24-11-15(21)22/h5-8,10,14,16H,2-4,9,11H2,1H3,(H,20,23)(H,21,22)/b19-10-/t14-,16+,18+/m0/s1 |
| InChIKey | AZTKVTYXXONLGD-RAQNOLLMSA-N |
| XLogP | 2.43 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|