C27H39N3O2S — CID 123454556
4-(4-methylphenyl)-N-[4-(4-piperidin-1-ylpiperidin-1-yl)butyl]benzenesulfonamide (PubChem CID 123454556) has the molecular formula C27H39N3O2S and a molecular weight of 469.70 g/mol. Its IUPAC name is 4-(4-methylphenyl)-N-[4-(4-piperidin-1-ylpiperidin-1-yl)butyl]benzenesulfonamide.
| Compound Name | 4-(4-methylphenyl)-N-[4-(4-piperidin-1-ylpiperidin-1-yl)butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 123454556 |
| Molecular Formula | C27H39N3O2S |
| Molecular Weight | 469.70 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | 4-(4-methylphenyl)-N-[4-(4-piperidin-1-ylpiperidin-1-yl)butyl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2ccc(S(=O)(=O)NCCCCN3CCC(N4CCCCC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H39N3O2S/c1-23-7-9-24(10-8-23)25-11-13-27(14-12-25)33(31,32)28-17-3-6-18-29-21-15-26(16-22-29)30-19-4-2-5-20-30/h7-14,26,28H,2-6,15-22H2,1H3 |
| InChIKey | JRVPNNPYRYRICY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.70 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|