C14H18N2O3S — CID 20958862
N,N-diethyl-4-(2-methyl-1,3-oxazol-5-yl)benzenesulfonamide (PubChem CID 20958862) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is N,N-diethyl-4-(2-methyl-1,3-oxazol-5-yl)benzenesulfonamide.
| Compound Name | N,N-diethyl-4-(2-methyl-1,3-oxazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 20958862 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N,N-diethyl-4-(2-methyl-1,3-oxazol-5-yl)benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(-c2cnc(C)o2)cc1 |
| InChI | InChI=1S/C14H18N2O3S/c1-4-16(5-2)20(17,18)13-8-6-12(7-9-13)14-10-15-11(3)19-14/h6-10H,4-5H2,1-3H3 |
| InChIKey | PQPXHJIRWKYJGI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |