C10H15NO2S2 — CID 15027344
N,N-diethyl-4-sulfanylbenzenesulfonamide (PubChem CID 15027344) has the molecular formula C10H15NO2S2 and a molecular weight of 245.37 g/mol. Its IUPAC name is N,N-diethyl-4-sulfanylbenzenesulfonamide.
| Compound Name | N,N-diethyl-4-sulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 15027344 |
| Molecular Formula | C10H15NO2S2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | N,N-diethyl-4-sulfanylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(S)cc1 |
| InChI | InChI=1S/C10H15NO2S2/c1-3-11(4-2)15(12,13)10-7-5-9(14)6-8-10/h5-8,14H,3-4H2,1-2H3 |
| InChIKey | KIQMPICJKOKAPY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|