C12H15NO2S — CID 163281778
4-(2-deuterioethynyl)-N,N-diethylbenzenesulfonamide (PubChem CID 163281778) has the molecular formula C12H15NO2S and a molecular weight of 238.33 g/mol. Its IUPAC name is 4-(2-deuterioethynyl)-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-(2-deuterioethynyl)-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 163281778 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 4-(2-deuterioethynyl)-N,N-diethylbenzenesulfonamide |
| SMILES | [2H]C#Cc1ccc(S(=O)(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C12H15NO2S/c1-4-11-7-9-12(10-8-11)16(14,15)13(5-2)6-3/h1,7-10H,5-6H2,2-3H3/i1D |
| InChIKey | MUGSEPSOYVZAAF-MICDWDOJSA-N |
| XLogP | 1.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|