C12H20N2O2S — CID 11043368
4-(dimethylamino)-N,N-diethylbenzenesulfonamide (PubChem CID 11043368) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 4-(dimethylamino)-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-(dimethylamino)-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 11043368 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 4-(dimethylamino)-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C12H20N2O2S/c1-5-14(6-2)17(15,16)12-9-7-11(8-10-12)13(3)4/h7-10H,5-6H2,1-4H3 |
| InChIKey | DGVVRYOPWMDGER-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |