C22H24N2O2S — CID 20654617
N,N-diethyl-4-(N-phenylanilino)benzenesulfonamide (PubChem CID 20654617) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is N,N-diethyl-4-(N-phenylanilino)benzenesulfonamide.
| Compound Name | N,N-diethyl-4-(N-phenylanilino)benzenesulfonamide |
|---|---|
| PubChem CID | 20654617 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N,N-diethyl-4-(N-phenylanilino)benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H24N2O2S/c1-3-23(4-2)27(25,26)22-17-15-21(16-18-22)24(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-18H,3-4H2,1-2H3 |
| InChIKey | CJNLWVLKVFKTNY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |