C13H23NO2SSi — CID 11254658
N,N-diethyl-4-trimethylsilylbenzenesulfonamide (PubChem CID 11254658) has the molecular formula C13H23NO2SSi and a molecular weight of 285.49 g/mol. Its IUPAC name is N,N-diethyl-4-trimethylsilylbenzenesulfonamide.
| Compound Name | N,N-diethyl-4-trimethylsilylbenzenesulfonamide |
|---|---|
| PubChem CID | 11254658 |
| Molecular Formula | C13H23NO2SSi |
| Molecular Weight | 285.49 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N,N-diethyl-4-trimethylsilylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C13H23NO2SSi/c1-6-14(7-2)17(15,16)12-8-10-13(11-9-12)18(3,4)5/h8-11H,6-7H2,1-5H3 |
| InChIKey | RVVQLEPELFIKOA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|