C13H16F6N2O2S — CID 24996616
4-(2-amino-1,1,1,3,3,3-hexafluoropropan-2-yl)-N,N-diethylbenzenesulfonamide (PubChem CID 24996616) has the molecular formula C13H16F6N2O2S and a molecular weight of 378.34 g/mol. Its IUPAC name is 4-(2-amino-1,1,1,3,3,3-hexafluoropropan-2-yl)-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-(2-amino-1,1,1,3,3,3-hexafluoropropan-2-yl)-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 24996616 |
| Molecular Formula | C13H16F6N2O2S |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 4-(2-amino-1,1,1,3,3,3-hexafluoropropan-2-yl)-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(N)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H16F6N2O2S/c1-3-21(4-2)24(22,23)10-7-5-9(6-8-10)11(20,12(14,15)16)13(17,18)19/h5-8H,3-4,20H2,1-2H3 |
| InChIKey | OKSLRDDVVNQHGO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |