C8H10LiNO3S — CID 59248340
lithium 4-(dimethylamino)benzenesulfonate (PubChem CID 59248340) has the molecular formula C8H10LiNO3S and a molecular weight of 207.18 g/mol. Its IUPAC name is lithium 4-(dimethylamino)benzenesulfonate.
| Compound Name | lithium 4-(dimethylamino)benzenesulfonate |
|---|---|
| PubChem CID | 59248340 |
| Molecular Formula | C8H10LiNO3S |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | lithium 4-(dimethylamino)benzenesulfonate |
| SMILES | CN(C)c1ccc(S(=O)(=O)[O-])cc1.[Li+] |
| InChI | InChI=1S/C8H11NO3S.Li/c1-9(2)7-3-5-8(6-4-7)13(10,11)12;/h3-6H,1-2H3,(H,10,11,12);/q;+1/p-1 |
| InChIKey | QQZVDLBNVIMNHM-UHFFFAOYSA-M |
| XLogP | -2.34 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|