C38H49NO5S2 — CID 22290416
4-tert-butylbenzenesulfonate;[4-(dimethylamino)phenyl]-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfanium (PubChem CID 22290416) has the molecular formula C38H49NO5S2 and a molecular weight of 663.95 g/mol. Its IUPAC name is 4-tert-butylbenzenesulfonate;[4-(dimethylamino)phenyl]-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfanium.
| Compound Name | 4-tert-butylbenzenesulfonate;[4-(dimethylamino)phenyl]-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 22290416 |
| Molecular Formula | C38H49NO5S2 |
| Molecular Weight | 663.95 g/mol |
| Exact Mass | 663.31 |
| IUPAC Name | 4-tert-butylbenzenesulfonate;[4-(dimethylamino)phenyl]-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfanium |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)[O-])cc1.CN(C)c1ccc([S+](c2ccc(OC(C)(C)C)cc2)c2ccc(OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H36NO2S.C10H14O3S/c1-27(2,3)30-22-11-17-25(18-12-22)32(24-15-9-21(10-16-24)29(7)8)26-19-13-23(14-20-26)31-28(4,5)6;1-10(2,3)8-4-6-9(7-5-8)14(11,12)13/h9-20H,1-8H3;4-7H,1-3H3,(H,11,12,13)/q+1;/p-1 |
| InChIKey | DYIVBFPHKJXFKR-UHFFFAOYSA-M |
| XLogP | 9.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.95 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|