C62H82O6S4 — CID 87388668
ethane-1,1-disulfonate;bis(tris(4-tert-butylphenyl)sulfanium) (PubChem CID 87388668) has the molecular formula C62H82O6S4 and a molecular weight of 1051.60 g/mol. Its IUPAC name is ethane-1,1-disulfonate;bis(tris(4-tert-butylphenyl)sulfanium).
| Compound Name | ethane-1,1-disulfonate;bis(tris(4-tert-butylphenyl)sulfanium) |
|---|---|
| PubChem CID | 87388668 |
| Molecular Formula | C62H82O6S4 |
| Molecular Weight | 1051.60 g/mol |
| Exact Mass | 1050.50 |
| IUPAC Name | ethane-1,1-disulfonate;bis(tris(4-tert-butylphenyl)sulfanium) |
| SMILES | CC(C)(C)c1ccc([S+](c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1.CC(C)(C)c1ccc([S+](c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1.CC(S(=O)(=O)[O-])S(=O)(=O)[O-] |
| InChI | InChI=1S/2C30H39S.C2H6O6S2/c2*1-28(2,3)22-10-16-25(17-11-22)31(26-18-12-23(13-19-26)29(4,5)6)27-20-14-24(15-21-27)30(7,8)9;1-2(9(3,4)5)10(6,7)8/h2*10-21H,1-9H3;2H,1H3,(H,3,4,5)(H,6,7,8)/q2*+1;/p-2 |
| InChIKey | KDLNWBDOSHFDFI-UHFFFAOYSA-L |
| XLogP | 15.77 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1051.60 |
| LogP ≤ 5 | 15.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|