C19H28N4O3S — CID 23276923
4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate;pentylazanium (PubChem CID 23276923) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate;pentylazanium.
| Compound Name | 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate;pentylazanium |
|---|---|
| PubChem CID | 23276923 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate;pentylazanium |
| SMILES | CCCCC[NH3+].CN(C)c1ccc(/N=N/c2ccc(S(=O)(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C14H15N3O3S.C5H13N/c1-17(2)13-7-3-11(4-8-13)15-16-12-5-9-14(10-6-12)21(18,19)20;1-2-3-4-5-6/h3-10H,1-2H3,(H,18,19,20);2-6H2,1H3/b16-15+; |
| InChIKey | LBULVUKFXOOPAD-GEEYTBSJSA-N |
| XLogP | 3.49 |
| TPSA | 112.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|