C18H18N2O3S — CID 20958761
N-benzyl-N-methyl-4-(2-methyl-1,3-oxazol-5-yl)benzenesulfonamide (PubChem CID 20958761) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-benzyl-N-methyl-4-(2-methyl-1,3-oxazol-5-yl)benzenesulfonamide.
| Compound Name | N-benzyl-N-methyl-4-(2-methyl-1,3-oxazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 20958761 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-benzyl-N-methyl-4-(2-methyl-1,3-oxazol-5-yl)benzenesulfonamide |
| SMILES | Cc1ncc(-c2ccc(S(=O)(=O)N(C)Cc3ccccc3)cc2)o1 |
| InChI | InChI=1S/C18H18N2O3S/c1-14-19-12-18(23-14)16-8-10-17(11-9-16)24(21,22)20(2)13-15-6-4-3-5-7-15/h3-12H,13H2,1-2H3 |
| InChIKey | OHHBIYXGFLTGDZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |