C18H19N3O2S — CID 17491199
N,4-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]benzenesulfonamide (PubChem CID 17491199) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is N,4-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | N,4-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 17491199 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N,4-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)Cc2cnn(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C18H19N3O2S/c1-15-8-10-18(11-9-15)24(22,23)20(2)13-16-12-19-21(14-16)17-6-4-3-5-7-17/h3-12,14H,13H2,1-2H3 |
| InChIKey | LARLIDIQWFBWMY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |