C17H15ClFN3O2S — CID 17495378
4-chloro-2-fluoro-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]benzenesulfonamide (PubChem CID 17495378) has the molecular formula C17H15ClFN3O2S and a molecular weight of 379.84 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 4-chloro-2-fluoro-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 17495378 |
| Molecular Formula | C17H15ClFN3O2S |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 4-chloro-2-fluoro-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]benzenesulfonamide |
| SMILES | CN(Cc1cnn(-c2ccccc2)c1)S(=O)(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C17H15ClFN3O2S/c1-21(25(23,24)17-8-7-14(18)9-16(17)19)11-13-10-20-22(12-13)15-5-3-2-4-6-15/h2-10,12H,11H2,1H3 |
| InChIKey | UHZBYXMCGIYYGD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |