C17H14F3N3O2S — CID 26541420
2,3,4-trifluoro-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]benzenesulfonamide (PubChem CID 26541420) has the molecular formula C17H14F3N3O2S and a molecular weight of 381.38 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26541420 |
| Molecular Formula | C17H14F3N3O2S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 2,3,4-trifluoro-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]benzenesulfonamide |
| SMILES | CN(Cc1cnn(-c2ccccc2)c1)S(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H14F3N3O2S/c1-22(26(24,25)15-8-7-14(18)16(19)17(15)20)10-12-9-21-23(11-12)13-5-3-2-4-6-13/h2-9,11H,10H2,1H3 |
| InChIKey | HBCSCJIKFSQNKU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|