C16H12F3N3O2S — CID 31841722
2,3,4-trifluoro-N-[(1-phenylpyrazol-4-yl)methyl]benzenesulfonamide (PubChem CID 31841722) has the molecular formula C16H12F3N3O2S and a molecular weight of 367.35 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[(1-phenylpyrazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[(1-phenylpyrazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 31841722 |
| Molecular Formula | C16H12F3N3O2S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 2,3,4-trifluoro-N-[(1-phenylpyrazol-4-yl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cnn(-c2ccccc2)c1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H12F3N3O2S/c17-13-6-7-14(16(19)15(13)18)25(23,24)21-9-11-8-20-22(10-11)12-4-2-1-3-5-12/h1-8,10,21H,9H2 |
| InChIKey | HXTBKLOKCNXRPS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|