C19H19FN4O3S — CID 55813430
5-(ethylsulfamoyl)-2-fluoro-N-[(1-phenylpyrazol-4-yl)methyl]benzamide (PubChem CID 55813430) has the molecular formula C19H19FN4O3S and a molecular weight of 402.45 g/mol. Its IUPAC name is 5-(ethylsulfamoyl)-2-fluoro-N-[(1-phenylpyrazol-4-yl)methyl]benzamide.
| Compound Name | 5-(ethylsulfamoyl)-2-fluoro-N-[(1-phenylpyrazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55813430 |
| Molecular Formula | C19H19FN4O3S |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 5-(ethylsulfamoyl)-2-fluoro-N-[(1-phenylpyrazol-4-yl)methyl]benzamide |
| SMILES | CCNS(=O)(=O)c1ccc(F)c(C(=O)NCc2cnn(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C19H19FN4O3S/c1-2-23-28(26,27)16-8-9-18(20)17(10-16)19(25)21-11-14-12-22-24(13-14)15-6-4-3-5-7-15/h3-10,12-13,23H,2,11H2,1H3,(H,21,25) |
| InChIKey | XFTDQFVLDDVYCE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |